About 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea
1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea (PubChem CID 175067978) has the molecular formula C12H13N5O2S
and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea.
Molecular Properties
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea |
| PubChem CID | 175067978 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea |
| SMILES | Cc1nc(N(NC(=O)c2ccncc2)C(N)=O)sc1C |
| InChI | InChI=1S/C12H13N5O2S/c1-7-8(2)20-12(15-7)17(11(13)19)16-10(18)9-3-5-14-6-4-9/h3-6H,1-2H3,(H2,13,19)(H,16,18) |
| InChIKey | DXOLEDYOUHHGPV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea?
The IUPAC name of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea (CID 175067978) is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea.
What is the SMILES notation for 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea?
The canonical SMILES for 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea is Cc1nc(N(NC(=O)c2ccncc2)C(N)=O)sc1C.
What is the InChIKey of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea?
The InChIKey is DXOLEDYOUHHGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O2S/c1-7-8(2)20-12(15-7)17(11(13)19)16-10(18)9-3-5-14-6-4-9/h3-6H,1-2H3,(H2,13,19)(H,16,18).
What are the key properties of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea?
1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea has a molecular weight of 291.34 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-1,3-thiazol-2-yl)-1-(pyridine-4-carbonylamino)urea is sourced from PubChem (CID 175067978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).