C16H16FN3O2S — CID 175068396
5-(4-fluorophenyl)-3-propan-2-yl-2-sulfanylidene-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 175068396) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-propan-2-yl-2-sulfanylidene-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(4-fluorophenyl)-3-propan-2-yl-2-sulfanylidene-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 175068396 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-(4-fluorophenyl)-3-propan-2-yl-2-sulfanylidene-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CC(C)n1c(=S)[nH]c2c(c1=O)C(c1ccc(F)cc1)CC(=O)N2 |
| InChI | InChI=1S/C16H16FN3O2S/c1-8(2)20-15(22)13-11(9-3-5-10(17)6-4-9)7-12(21)18-14(13)19-16(20)23/h3-6,8,11H,7H2,1-2H3,(H,18,21)(H,19,23) |
| InChIKey | GXUWBQCVDMWZAK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|