About 1,2-diethyl-3,5-dipropylpiperidine;hydrate
1,2-diethyl-3,5-dipropylpiperidine;hydrate (PubChem CID 175068632) has the molecular formula C15H33NO
and a molecular weight of 243.43 g/mol. Its IUPAC name is 1,2-diethyl-3,5-dipropylpiperidine;hydrate.
Molecular Properties
| Compound Name | 1,2-diethyl-3,5-dipropylpiperidine;hydrate |
| PubChem CID | 175068632 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 1,2-diethyl-3,5-dipropylpiperidine;hydrate |
| SMILES | CCCC1CC(CCC)C(CC)N(CC)C1.O |
| InChI | InChI=1S/C15H31N.H2O/c1-5-9-13-11-14(10-6-2)15(7-3)16(8-4)12-13;/h13-15H,5-12H2,1-4H3;1H2 |
| InChIKey | GWVNPWNKNSGUIH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-diethyl-3,5-dipropylpiperidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-3,5-dipropylpiperidine;hydrate?
The IUPAC name of 1,2-diethyl-3,5-dipropylpiperidine;hydrate (CID 175068632) is 1,2-diethyl-3,5-dipropylpiperidine;hydrate.
What is the SMILES notation for 1,2-diethyl-3,5-dipropylpiperidine;hydrate?
The canonical SMILES for 1,2-diethyl-3,5-dipropylpiperidine;hydrate is CCCC1CC(CCC)C(CC)N(CC)C1.O.
What is the InChIKey of 1,2-diethyl-3,5-dipropylpiperidine;hydrate?
The InChIKey is GWVNPWNKNSGUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N.H2O/c1-5-9-13-11-14(10-6-2)15(7-3)16(8-4)12-13;/h13-15H,5-12H2,1-4H3;1H2.
What are the key properties of 1,2-diethyl-3,5-dipropylpiperidine;hydrate?
1,2-diethyl-3,5-dipropylpiperidine;hydrate has a molecular weight of 243.43 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-3,5-dipropylpiperidine;hydrate is sourced from PubChem (CID 175068632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).