About hexane;3-phenylbenzene-1,2-diamine
hexane;3-phenylbenzene-1,2-diamine (PubChem CID 175068745) has the molecular formula C18H26N2
and a molecular weight of 270.42 g/mol. Its IUPAC name is hexane;3-phenylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | hexane;3-phenylbenzene-1,2-diamine |
| PubChem CID | 175068745 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | hexane;3-phenylbenzene-1,2-diamine |
| SMILES | CCCCCC.Nc1cccc(-c2ccccc2)c1N |
| InChI | InChI=1S/C12H12N2.C6H14/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-3-5-6-4-2/h1-8H,13-14H2;3-6H2,1-2H3 |
| InChIKey | WOUSVTVAQIJIOH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze hexane;3-phenylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;3-phenylbenzene-1,2-diamine?
The IUPAC name of hexane;3-phenylbenzene-1,2-diamine (CID 175068745) is hexane;3-phenylbenzene-1,2-diamine.
What is the SMILES notation for hexane;3-phenylbenzene-1,2-diamine?
The canonical SMILES for hexane;3-phenylbenzene-1,2-diamine is CCCCCC.Nc1cccc(-c2ccccc2)c1N.
What is the InChIKey of hexane;3-phenylbenzene-1,2-diamine?
The InChIKey is WOUSVTVAQIJIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C6H14/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-3-5-6-4-2/h1-8H,13-14H2;3-6H2,1-2H3.
What are the key properties of hexane;3-phenylbenzene-1,2-diamine?
hexane;3-phenylbenzene-1,2-diamine has a molecular weight of 270.42 g/mol, XLogP of 5.10, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;3-phenylbenzene-1,2-diamine is sourced from PubChem (CID 175068745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).