About 6-(trifluoromethyl)-2,3-dihydroquinoxaline
6-(trifluoromethyl)-2,3-dihydroquinoxaline (PubChem CID 175068942) has the molecular formula C9H7F3N2
and a molecular weight of 200.16 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-2,3-dihydroquinoxaline |
| PubChem CID | 175068942 |
| Molecular Formula | C9H7F3N2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 6-(trifluoromethyl)-2,3-dihydroquinoxaline |
| SMILES | FC(F)(F)c1ccc2c(c1)=NCCN=2 |
| InChI | InChI=1S/C9H7F3N2/c10-9(11,12)6-1-2-7-8(5-6)14-4-3-13-7/h1-2,5H,3-4H2 |
| InChIKey | WTAVJMSKWDXXTI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-2,3-dihydroquinoxaline?
The IUPAC name of 6-(trifluoromethyl)-2,3-dihydroquinoxaline (CID 175068942) is 6-(trifluoromethyl)-2,3-dihydroquinoxaline.
What is the SMILES notation for 6-(trifluoromethyl)-2,3-dihydroquinoxaline?
The canonical SMILES for 6-(trifluoromethyl)-2,3-dihydroquinoxaline is FC(F)(F)c1ccc2c(c1)=NCCN=2.
What is the InChIKey of 6-(trifluoromethyl)-2,3-dihydroquinoxaline?
The InChIKey is WTAVJMSKWDXXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2/c10-9(11,12)6-1-2-7-8(5-6)14-4-3-13-7/h1-2,5H,3-4H2.
What are the key properties of 6-(trifluoromethyl)-2,3-dihydroquinoxaline?
6-(trifluoromethyl)-2,3-dihydroquinoxaline has a molecular weight of 200.16 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-2,3-dihydroquinoxaline is sourced from PubChem (CID 175068942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).