C18H25NO3 — CID 175069255
2-[[1-(7-methoxy-1-benzofuran-2-yl)ethylamino]methyl]cyclohexan-1-ol (PubChem CID 175069255) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-[[1-(7-methoxy-1-benzofuran-2-yl)ethylamino]methyl]cyclohexan-1-ol.
| Compound Name | 2-[[1-(7-methoxy-1-benzofuran-2-yl)ethylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 175069255 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[[1-(7-methoxy-1-benzofuran-2-yl)ethylamino]methyl]cyclohexan-1-ol |
| SMILES | COc1cccc2cc(C(C)NCC3CCCCC3O)oc12 |
| InChI | InChI=1S/C18H25NO3/c1-12(19-11-14-6-3-4-8-15(14)20)17-10-13-7-5-9-16(21-2)18(13)22-17/h5,7,9-10,12,14-15,19-20H,3-4,6,8,11H2,1-2H3 |
| InChIKey | AMKHCKWJULRNCU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |