C13H10Br3N3OP+ — CID 175070069
tribromo-[5-[4-(hydroxymethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phosphanium (PubChem CID 175070069) has the molecular formula C13H10Br3N3OP+ and a molecular weight of 494.93 g/mol. Its IUPAC name is tribromo-[5-[4-(hydroxymethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phosphanium.
| Compound Name | tribromo-[5-[4-(hydroxymethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phosphanium |
|---|---|
| PubChem CID | 175070069 |
| Molecular Formula | C13H10Br3N3OP+ |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 491.81 |
| IUPAC Name | tribromo-[5-[4-(hydroxymethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phosphanium |
| SMILES | OCc1ccc(-c2cccc3nc([P+](Br)(Br)Br)nn23)cc1 |
| InChI | InChI=1S/C13H10Br3N3OP/c14-21(15,16)13-17-12-3-1-2-11(19(12)18-13)10-6-4-9(8-20)5-7-10/h1-7,20H,8H2/q+1 |
| InChIKey | VZCJYEYYMMMMCZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|