C23H21FN4O — CID 175070887
2-[3-[2-(3-cyclopropylindazol-1-yl)pyrimidin-5-yl]-4-fluorophenyl]propan-2-ol (PubChem CID 175070887) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[3-[2-(3-cyclopropylindazol-1-yl)pyrimidin-5-yl]-4-fluorophenyl]propan-2-ol.
| Compound Name | 2-[3-[2-(3-cyclopropylindazol-1-yl)pyrimidin-5-yl]-4-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 175070887 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[3-[2-(3-cyclopropylindazol-1-yl)pyrimidin-5-yl]-4-fluorophenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(F)c(-c2cnc(-n3nc(C4CC4)c4ccccc43)nc2)c1 |
| InChI | InChI=1S/C23H21FN4O/c1-23(2,29)16-9-10-19(24)18(11-16)15-12-25-22(26-13-15)28-20-6-4-3-5-17(20)21(27-28)14-7-8-14/h3-6,9-14,29H,7-8H2,1-2H3 |
| InChIKey | RXZQNYSXNQIHEQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |