About 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene
2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene (PubChem CID 175071405) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene.
Molecular Properties
| Compound Name | 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene |
| PubChem CID | 175071405 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene |
| SMILES | CCCc1ccc2cc1O2 |
| InChI | InChI=1S/C9H10O/c1-2-3-7-4-5-8-6-9(7)10-8/h4-6H,2-3H2,1H3 |
| InChIKey | YXQKTKWXOWKNPH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene?
The IUPAC name of 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene (CID 175071405) is 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene.
What is the SMILES notation for 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene?
The canonical SMILES for 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene is CCCc1ccc2cc1O2.
What is the InChIKey of 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene?
The InChIKey is YXQKTKWXOWKNPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-2-3-7-4-5-8-6-9(7)10-8/h4-6H,2-3H2,1H3.
What are the key properties of 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene?
2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene has a molecular weight of 134.18 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene is sourced from PubChem (CID 175071405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).