About alumane;trioctyl phosphate
alumane;trioctyl phosphate (PubChem CID 175071420) has the molecular formula C24H54AlO4P
and a molecular weight of 464.65 g/mol. Its IUPAC name is alumane;trioctyl phosphate.
Molecular Properties
| Compound Name | alumane;trioctyl phosphate |
| PubChem CID | 175071420 |
| Molecular Formula | C24H54AlO4P |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.36 |
| IUPAC Name | alumane;trioctyl phosphate |
| SMILES | CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC.[AlH3] |
| InChI | InChI=1S/C24H51O4P.Al.3H/c1-4-7-10-13-16-19-22-26-29(25,27-23-20-17-14-11-8-5-2)28-24-21-18-15-12-9-6-3;;;;/h4-24H2,1-3H3;;;; |
| InChIKey | JGRCOAPGNSEYLY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;trioctyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;trioctyl phosphate?
The IUPAC name of alumane;trioctyl phosphate (CID 175071420) is alumane;trioctyl phosphate.
What is the SMILES notation for alumane;trioctyl phosphate?
The canonical SMILES for alumane;trioctyl phosphate is CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC.[AlH3].
What is the InChIKey of alumane;trioctyl phosphate?
The InChIKey is JGRCOAPGNSEYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51O4P.Al.3H/c1-4-7-10-13-16-19-22-26-29(25,27-23-20-17-14-11-8-5-2)28-24-21-18-15-12-9-6-3;;;;/h4-24H2,1-3H3;;;;.
What are the key properties of alumane;trioctyl phosphate?
alumane;trioctyl phosphate has a molecular weight of 464.65 g/mol, XLogP of 8.04, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;trioctyl phosphate is sourced from PubChem (CID 175071420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).