About 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide
2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide (PubChem CID 175071452) has the molecular formula C5H10BrN5S
and a molecular weight of 252.14 g/mol. Its IUPAC name is 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide.
Molecular Properties
| Compound Name | 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide |
| PubChem CID | 175071452 |
| Molecular Formula | C5H10BrN5S |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide |
| SMILES | Br.Cc1nnnn1C1NCCS1 |
| InChI | InChI=1S/C5H9N5S.BrH/c1-4-7-8-9-10(4)5-6-2-3-11-5;/h5-6H,2-3H2,1H3;1H |
| InChIKey | BCGWGUXMWSJBAM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide?
The IUPAC name of 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide (CID 175071452) is 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide.
What is the SMILES notation for 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide?
The canonical SMILES for 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide is Br.Cc1nnnn1C1NCCS1.
What is the InChIKey of 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide?
The InChIKey is BCGWGUXMWSJBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5S.BrH/c1-4-7-8-9-10(4)5-6-2-3-11-5;/h5-6H,2-3H2,1H3;1H.
What are the key properties of 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide?
2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide has a molecular weight of 252.14 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyltetrazol-1-yl)-1,3-thiazolidine;hydrobromide is sourced from PubChem (CID 175071452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).