C29H54O7SSi3 — CID 175071529
(2R,3S,4S)-6-(benzenesulfonyl)-3-tert-butylsilyl-2-(tert-butylsilyloxymethyl)-4-tri(propan-2-yl)silyloxy-2H-pyran-3,4-diol (PubChem CID 175071529) has the molecular formula C29H54O7SSi3 and a molecular weight of 631.07 g/mol. Its IUPAC name is (2R,3S,4S)-6-(benzenesulfonyl)-3-tert-butylsilyl-2-(tert-butylsilyloxymethyl)-4-tri(propan-2-yl)silyloxy-2H-pyran-3,4-diol.
| Compound Name | (2R,3S,4S)-6-(benzenesulfonyl)-3-tert-butylsilyl-2-(tert-butylsilyloxymethyl)-4-tri(propan-2-yl)silyloxy-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 175071529 |
| Molecular Formula | C29H54O7SSi3 |
| Molecular Weight | 631.07 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | (2R,3S,4S)-6-(benzenesulfonyl)-3-tert-butylsilyl-2-(tert-butylsilyloxymethyl)-4-tri(propan-2-yl)silyloxy-2H-pyran-3,4-diol |
| SMILES | CC(C)[Si](O[C@@]1(O)C=C(S(=O)(=O)c2ccccc2)O[C@H](CO[SiH2]C(C)(C)C)[C@]1(O)[SiH2]C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H54O7SSi3/c1-20(2)40(21(3)4,22(5)6)36-28(30)18-25(37(32,33)23-16-14-13-15-17-23)35-24(19-34-39-27(10,11)12)29(28,31)38-26(7,8)9/h13-18,20-22,24,30-31H,19,38-39H2,1-12H3/t24-,28+,29+/m1/s1 |
| InChIKey | GSFIOTZESHAOJI-MHZHKKNFSA-N |
| XLogP | 4.98 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.07 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|