C7H12Cl2Si — CID 175071544
dichloro(hepta-2,4-dienyl)silane (PubChem CID 175071544) has the molecular formula C7H12Cl2Si and a molecular weight of 195.17 g/mol. Its IUPAC name is dichloro(hepta-2,4-dienyl)silane.
| Compound Name | dichloro(hepta-2,4-dienyl)silane |
|---|---|
| PubChem CID | 175071544 |
| Molecular Formula | C7H12Cl2Si |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | dichloro(hepta-2,4-dienyl)silane |
| SMILES | CCC=CC=CC[SiH](Cl)Cl |
| InChI | InChI=1S/C7H12Cl2Si/c1-2-3-4-5-6-7-10(8)9/h3-6,10H,2,7H2,1H3 |
| InChIKey | ZCQUTGOYYXSLRR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|