C26H27FN2O2 — CID 175071762
(E)-3-[4-[(1R,3R)-2-(cyclobutylmethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluorophenyl]prop-2-enoic acid (PubChem CID 175071762) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is (E)-3-[4-[(1R,3R)-2-(cyclobutylmethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1R,3R)-2-(cyclobutylmethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175071762 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (E)-3-[4-[(1R,3R)-2-(cyclobutylmethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-fluorophenyl]prop-2-enoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(/C=C/C(=O)O)cc2F)N1CC1CCC1 |
| InChI | InChI=1S/C26H27FN2O2/c1-16-13-21-19-7-2-3-8-23(19)28-25(21)26(29(16)15-18-5-4-6-18)20-11-9-17(14-22(20)27)10-12-24(30)31/h2-3,7-12,14,16,18,26,28H,4-6,13,15H2,1H3,(H,30,31)/b12-10+/t16-,26-/m1/s1 |
| InChIKey | IMPUHFWHHHSFSU-WSZWFMGHSA-N |
| XLogP | 5.54 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|