About 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate
4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate (PubChem CID 175072114) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate.
Molecular Properties
| Compound Name | 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate |
| PubChem CID | 175072114 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate |
| SMILES | C1=NCCO1.COC(=O)CC#N |
| InChI | InChI=1S/C4H5NO2.C3H5NO/c1-7-4(6)2-3-5;1-2-5-3-4-1/h2H2,1H3;3H,1-2H2 |
| InChIKey | JHKUCKCLLRCQBR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate?
The IUPAC name of 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate (CID 175072114) is 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate.
What is the SMILES notation for 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate?
The canonical SMILES for 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate is C1=NCCO1.COC(=O)CC#N.
What is the InChIKey of 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate?
The InChIKey is JHKUCKCLLRCQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C3H5NO/c1-7-4(6)2-3-5;1-2-5-3-4-1/h2H2,1H3;3H,1-2H2.
What are the key properties of 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate?
4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate has a molecular weight of 170.17 g/mol, XLogP of 0.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,3-oxazole;methyl 2-cyanoacetate is sourced from PubChem (CID 175072114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).