About 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde
4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde (PubChem CID 175072422) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde |
| PubChem CID | 175072422 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H15F3N2O/c10-9(11,12)3-4-13-8-1-5-14(7-15)6-2-8/h7-8,13H,1-6H2 |
| InChIKey | NJVJFBKJVPYGAJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde?
The IUPAC name of 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde (CID 175072422) is 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde.
What is the SMILES notation for 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde?
The canonical SMILES for 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde is O=CN1CCC(NCCC(F)(F)F)CC1.
What is the InChIKey of 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde?
The InChIKey is NJVJFBKJVPYGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O/c10-9(11,12)3-4-13-8-1-5-14(7-15)6-2-8/h7-8,13H,1-6H2.
What are the key properties of 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde?
4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde has a molecular weight of 224.23 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3,3-trifluoropropylamino)piperidine-1-carbaldehyde is sourced from PubChem (CID 175072422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).