About sodium;carbamoyliminourea;hydride
sodium;carbamoyliminourea;hydride (PubChem CID 175072708) has the molecular formula C2H5N4NaO2
and a molecular weight of 140.08 g/mol. Its IUPAC name is sodium;carbamoyliminourea;hydride.
Molecular Properties
| Compound Name | sodium;carbamoyliminourea;hydride |
| PubChem CID | 175072708 |
| Molecular Formula | C2H5N4NaO2 |
| Molecular Weight | 140.08 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | sodium;carbamoyliminourea;hydride |
| SMILES | NC(=O)N=NC(N)=O.[H-].[Na+] |
| InChI | InChI=1S/C2H4N4O2.Na.H/c3-1(7)5-6-2(4)8;;/h(H2,3,7)(H2,4,8);;/q;+1;-1 |
| InChIKey | XXQSDRBGZKZJSW-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.08 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbamoyliminourea;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbamoyliminourea;hydride?
The IUPAC name of sodium;carbamoyliminourea;hydride (CID 175072708) is sodium;carbamoyliminourea;hydride.
What is the SMILES notation for sodium;carbamoyliminourea;hydride?
The canonical SMILES for sodium;carbamoyliminourea;hydride is NC(=O)N=NC(N)=O.[H-].[Na+].
What is the InChIKey of sodium;carbamoyliminourea;hydride?
The InChIKey is XXQSDRBGZKZJSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4O2.Na.H/c3-1(7)5-6-2(4)8;;/h(H2,3,7)(H2,4,8);;/q;+1;-1.
What are the key properties of sodium;carbamoyliminourea;hydride?
sodium;carbamoyliminourea;hydride has a molecular weight of 140.08 g/mol, XLogP of -3.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbamoyliminourea;hydride is sourced from PubChem (CID 175072708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).