About 2,3-diphenylpiperazine;hydrochloride
2,3-diphenylpiperazine;hydrochloride (PubChem CID 175072756) has the molecular formula C16H19ClN2
and a molecular weight of 274.80 g/mol. Its IUPAC name is 2,3-diphenylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 2,3-diphenylpiperazine;hydrochloride |
| PubChem CID | 175072756 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2,3-diphenylpiperazine;hydrochloride |
| SMILES | Cl.c1ccc(C2NCCNC2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2.ClH/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14;/h1-10,15-18H,11-12H2;1H |
| InChIKey | MYAROUFPWKRVGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diphenylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylpiperazine;hydrochloride?
The IUPAC name of 2,3-diphenylpiperazine;hydrochloride (CID 175072756) is 2,3-diphenylpiperazine;hydrochloride.
What is the SMILES notation for 2,3-diphenylpiperazine;hydrochloride?
The canonical SMILES for 2,3-diphenylpiperazine;hydrochloride is Cl.c1ccc(C2NCCNC2c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenylpiperazine;hydrochloride?
The InChIKey is MYAROUFPWKRVGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2.ClH/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14;/h1-10,15-18H,11-12H2;1H.
What are the key properties of 2,3-diphenylpiperazine;hydrochloride?
2,3-diphenylpiperazine;hydrochloride has a molecular weight of 274.80 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylpiperazine;hydrochloride is sourced from PubChem (CID 175072756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).