About CID 175074255
CID 175074255 (PubChem CID 175074255) has the molecular formula C19H16Cl3F2N2O3Se
and a molecular weight of 543.66 g/mol.
Molecular Properties
| Compound Name | CID 175074255 |
| PubChem CID | 175074255 |
| Molecular Formula | C19H16Cl3F2N2O3Se |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 542.94 |
| IUPAC Name | — |
| SMILES | O=[Se](=O)C1N(CC(OCc2ccc(Cl)cc2)c2ccc(Cl)cc2Cl)C=CN1C(F)F |
| InChI | InChI=1S/C19H16Cl3F2N2O3Se/c20-13-3-1-12(2-4-13)11-29-17(15-6-5-14(21)9-16(15)22)10-25-7-8-26(18(23)24)19(25)30(27)28/h1-9,17-19H,10-11H2 |
| InChIKey | SWTWFSVOMUGEHM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 175074255 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175074255?
The IUPAC name of CID 175074255 (CID 175074255) is not available.
What is the SMILES notation for CID 175074255?
The canonical SMILES for CID 175074255 is O=[Se](=O)C1N(CC(OCc2ccc(Cl)cc2)c2ccc(Cl)cc2Cl)C=CN1C(F)F.
What is the InChIKey of CID 175074255?
The InChIKey is SWTWFSVOMUGEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl3F2N2O3Se/c20-13-3-1-12(2-4-13)11-29-17(15-6-5-14(21)9-16(15)22)10-25-7-8-26(18(23)24)19(25)30(27)28/h1-9,17-19H,10-11H2.
What are the key properties of CID 175074255?
CID 175074255 has a molecular weight of 543.66 g/mol, XLogP of 5.43, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175074255 is sourced from PubChem (CID 175074255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).