C15H19ClF3N — CID 175074556
(1S)-4-chloro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 175074556) has the molecular formula C15H19ClF3N and a molecular weight of 305.77 g/mol. Its IUPAC name is (1S)-4-chloro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine.
| Compound Name | (1S)-4-chloro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 175074556 |
| Molecular Formula | C15H19ClF3N |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (1S)-4-chloro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | CN(C)[C@H]1CCC(Cl)C(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H19ClF3N/c1-20(2)12-6-7-14(16)13(9-12)10-4-3-5-11(8-10)15(17,18)19/h3-5,8,12-14H,6-7,9H2,1-2H3/t12-,13?,14?/m0/s1 |
| InChIKey | QGRDQWUMCKOAMX-HSBZDZAISA-N |
| XLogP | 4.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|