C7H11N3OS3 — CID 175074952
6-(2-sulfanylbutoxy)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 175074952) has the molecular formula C7H11N3OS3 and a molecular weight of 249.39 g/mol. Its IUPAC name is 6-(2-sulfanylbutoxy)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(2-sulfanylbutoxy)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 175074952 |
| Molecular Formula | C7H11N3OS3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 6-(2-sulfanylbutoxy)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCC(S)COc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C7H11N3OS3/c1-2-4(12)3-11-5-8-6(13)10-7(14)9-5/h4,12H,2-3H2,1H3,(H2,8,9,10,13,14) |
| InChIKey | LAQKDJWLMMTWIU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|