About 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate
2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate (PubChem CID 175075116) has the molecular formula C6H14N2OS2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate.
Molecular Properties
| Compound Name | 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate |
| PubChem CID | 175075116 |
| Molecular Formula | C6H14N2OS2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate |
| SMILES | CC(CSS)C1=NCCN1.O |
| InChI | InChI=1S/C6H12N2S2.H2O/c1-5(4-10-9)6-7-2-3-8-6;/h5,9H,2-4H2,1H3,(H,7,8);1H2 |
| InChIKey | OXJAVJPFEAWTRF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate?
The IUPAC name of 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate (CID 175075116) is 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate.
What is the SMILES notation for 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate?
The canonical SMILES for 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate is CC(CSS)C1=NCCN1.O.
What is the InChIKey of 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate?
The InChIKey is OXJAVJPFEAWTRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S2.H2O/c1-5(4-10-9)6-7-2-3-8-6;/h5,9H,2-4H2,1H3,(H,7,8);1H2.
What are the key properties of 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate?
2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate has a molecular weight of 194.32 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(disulfanyl)propan-2-yl]-4,5-dihydro-1H-imidazole;hydrate is sourced from PubChem (CID 175075116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).