About [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate (PubChem CID 175076089) has the molecular formula C23H27F3O5SSi
and a molecular weight of 500.61 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate |
| PubChem CID | 175076089 |
| Molecular Formula | C23H27F3O5SSi |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](OCC1CCC(OS(=O)(=O)C(F)(F)F)=CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27F3O5SSi/c1-22(2,3)33(20-10-6-4-7-11-20,21-12-8-5-9-13-21)30-17-18-14-15-19(16-29-18)31-32(27,28)23(24,25)26/h4-13,16,18H,14-15,17H2,1-3H3 |
| InChIKey | HDTRDZHMNOYXJI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate?
The IUPAC name of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate (CID 175076089) is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate.
What is the SMILES notation for [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate?
The canonical SMILES for [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate is CC(C)(C)[Si](OCC1CCC(OS(=O)(=O)C(F)(F)F)=CO1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate?
The InChIKey is HDTRDZHMNOYXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27F3O5SSi/c1-22(2,3)33(20-10-6-4-7-11-20,21-12-8-5-9-13-21)30-17-18-14-15-19(16-29-18)31-32(27,28)23(24,25)26/h4-13,16,18H,14-15,17H2,1-3H3.
What are the key properties of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate?
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate has a molecular weight of 500.61 g/mol, XLogP of 4.45, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-5-yl] trifluoromethanesulfonate is sourced from PubChem (CID 175076089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).