C27H33FN2O — CID 175076463
N-[5-[1-[(4-fluorophenyl)methyl]-6,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-3,3-dimethylpent-4-ynyl]formamide (PubChem CID 175076463) has the molecular formula C27H33FN2O and a molecular weight of 420.57 g/mol. Its IUPAC name is N-[5-[1-[(4-fluorophenyl)methyl]-6,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-3,3-dimethylpent-4-ynyl]formamide.
| Compound Name | N-[5-[1-[(4-fluorophenyl)methyl]-6,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-3,3-dimethylpent-4-ynyl]formamide |
|---|---|
| PubChem CID | 175076463 |
| Molecular Formula | C27H33FN2O |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N-[5-[1-[(4-fluorophenyl)methyl]-6,8-dimethyl-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-3,3-dimethylpent-4-ynyl]formamide |
| SMILES | Cc1cc2c(c(C)c1C#CC(C)(C)CCNC=O)CCCCN2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H33FN2O/c1-20-17-26-25(21(2)24(20)12-13-27(3,4)14-15-29-19-31)7-5-6-16-30(26)18-22-8-10-23(28)11-9-22/h8-11,17,19H,5-7,14-16,18H2,1-4H3,(H,29,31) |
| InChIKey | GWQTYNCOTFENLR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|