About (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde
(4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde (PubChem CID 175077173) has the molecular formula C11H10F2O2
and a molecular weight of 212.19 g/mol. Its IUPAC name is (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde.
Molecular Properties
| Compound Name | (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde |
| PubChem CID | 175077173 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde |
| SMILES | O=CC1C[C@H](c2ccc(F)c(F)c2)CO1 |
| InChI | InChI=1S/C11H10F2O2/c12-10-2-1-7(4-11(10)13)8-3-9(5-14)15-6-8/h1-2,4-5,8-9H,3,6H2/t8-,9?/m0/s1 |
| InChIKey | GHOYUYOWHJXTJH-IENPIDJESA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde?
The IUPAC name of (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde (CID 175077173) is (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde.
What is the SMILES notation for (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde?
The canonical SMILES for (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde is O=CC1C[C@H](c2ccc(F)c(F)c2)CO1.
What is the InChIKey of (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde?
The InChIKey is GHOYUYOWHJXTJH-IENPIDJESA-N. The full InChI is InChI=1S/C11H10F2O2/c12-10-2-1-7(4-11(10)13)8-3-9(5-14)15-6-8/h1-2,4-5,8-9H,3,6H2/t8-,9?/m0/s1.
What are the key properties of (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde?
(4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde has a molecular weight of 212.19 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(3,4-difluorophenyl)oxolane-2-carbaldehyde is sourced from PubChem (CID 175077173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).