About sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole
sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole (PubChem CID 175077259) has the molecular formula C11H20N3NaS2
and a molecular weight of 281.43 g/mol. Its IUPAC name is sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole |
| PubChem CID | 175077259 |
| Molecular Formula | C11H20N3NaS2 |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole |
| SMILES | CCN(CC)NC(=S)[S-].Cc1c[nH]c(C)c1.[Na+] |
| InChI | InChI=1S/C6H9N.C5H12N2S2.Na/c1-5-3-6(2)7-4-5;1-3-7(4-2)6-5(8)9;/h3-4,7H,1-2H3;3-4H2,1-2H3,(H2,6,8,9);/q;;+1/p-1 |
| InChIKey | BZUORFNLOSJTES-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole?
The IUPAC name of sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole (CID 175077259) is sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole.
What is the SMILES notation for sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole?
The canonical SMILES for sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole is CCN(CC)NC(=S)[S-].Cc1c[nH]c(C)c1.[Na+].
What is the InChIKey of sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole?
The InChIKey is BZUORFNLOSJTES-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9N.C5H12N2S2.Na/c1-5-3-6(2)7-4-5;1-3-7(4-2)6-5(8)9;/h3-4,7H,1-2H3;3-4H2,1-2H3,(H2,6,8,9);/q;;+1/p-1.
What are the key properties of sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole?
sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole has a molecular weight of 281.43 g/mol, XLogP of -0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N-(diethylamino)carbamodithioate;2,4-dimethyl-1H-pyrrole is sourced from PubChem (CID 175077259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).