C24H30N4O4 — CID 175077923
3-[[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]benzoyl]amino]propylcarbamic acid (PubChem CID 175077923) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]benzoyl]amino]propylcarbamic acid.
| Compound Name | 3-[[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]benzoyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 175077923 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-[[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]benzoyl]amino]propylcarbamic acid |
| SMILES | CCC(=O)N1c2ccccc2[C@H](Nc2ccc(C(=O)NCCCNC(=O)O)cc2)C[C@@H]1C |
| InChI | InChI=1S/C24H30N4O4/c1-3-22(29)28-16(2)15-20(19-7-4-5-8-21(19)28)27-18-11-9-17(10-12-18)23(30)25-13-6-14-26-24(31)32/h4-5,7-12,16,20,26-27H,3,6,13-15H2,1-2H3,(H,25,30)(H,31,32)/t16-,20+/m0/s1 |
| InChIKey | HRSNXRYANVFNGI-OXJNMPFZSA-N |
| XLogP | 3.76 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|