C24H26N4O4 — CID 175077941
[4-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]anilino]-4-oxobut-2-ynyl] carbamate (PubChem CID 175077941) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is [4-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]anilino]-4-oxobut-2-ynyl] carbamate.
| Compound Name | [4-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]anilino]-4-oxobut-2-ynyl] carbamate |
|---|---|
| PubChem CID | 175077941 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [4-[4-[[(2S,4R)-2-methyl-1-propanoyl-3,4-dihydro-2H-quinolin-4-yl]amino]anilino]-4-oxobut-2-ynyl] carbamate |
| SMILES | CCC(=O)N1c2ccccc2[C@H](Nc2ccc(NC(=O)C#CCOC(N)=O)cc2)C[C@@H]1C |
| InChI | InChI=1S/C24H26N4O4/c1-3-23(30)28-16(2)15-20(19-7-4-5-8-21(19)28)26-17-10-12-18(13-11-17)27-22(29)9-6-14-32-24(25)31/h4-5,7-8,10-13,16,20,26H,3,14-15H2,1-2H3,(H2,25,31)(H,27,29)/t16-,20+/m0/s1 |
| InChIKey | XFVQFLAAIBIKKC-OXJNMPFZSA-N |
| XLogP | 3.41 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|