About 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide
2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide (PubChem CID 175078618) has the molecular formula C16H19N5O
and a molecular weight of 297.36 g/mol. Its IUPAC name is 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide.
Molecular Properties
| Compound Name | 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide |
| PubChem CID | 175078618 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide |
| SMILES | Cc1cnc2c(n1)nc(C)n2C(C)c1ccccc1.NC=O |
| InChI | InChI=1S/C15H16N4.CH3NO/c1-10-9-16-15-14(17-10)18-12(3)19(15)11(2)13-7-5-4-6-8-13;2-1-3/h4-9,11H,1-3H3;1H,(H2,2,3) |
| InChIKey | PXSCGKUJPXOBMS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide?
The IUPAC name of 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide (CID 175078618) is 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide.
What is the SMILES notation for 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide?
The canonical SMILES for 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide is Cc1cnc2c(n1)nc(C)n2C(C)c1ccccc1.NC=O.
What is the InChIKey of 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide?
The InChIKey is PXSCGKUJPXOBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4.CH3NO/c1-10-9-16-15-14(17-10)18-12(3)19(15)11(2)13-7-5-4-6-8-13;2-1-3/h4-9,11H,1-3H3;1H,(H2,2,3).
What are the key properties of 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide?
2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide has a molecular weight of 297.36 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-(1-phenylethyl)imidazo[4,5-b]pyrazine;formamide is sourced from PubChem (CID 175078618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).