C16F30 — CID 175078772
3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl]cyclobutene (PubChem CID 175078772) has the molecular formula C16F30 and a molecular weight of 762.12 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl]cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl]cyclobutene |
|---|---|
| PubChem CID | 175078772 |
| Molecular Formula | C16F30 |
| Molecular Weight | 762.12 g/mol |
| Exact Mass | 761.95 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl]cyclobutene |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(C1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16F30/c17-5(18)1(3(9(23,24)25,10(26,27)28)7(21,13(35,36)37)14(38,39)40)2(6(5,19)20)4(11(29,30)31,12(32,33)34)8(22,15(41,42)43)16(44,45)46 |
| InChIKey | UIGCAEILZDWXAV-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.12 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|