C24H23FN6O4S — CID 175078857
[6-[[4-(3-cyclopentyl-2-methylbenzimidazol-5-yl)-5-fluoropyrimidin-2-yl]amino]-3-pyridinyl]methylsulfonyl formate (PubChem CID 175078857) has the molecular formula C24H23FN6O4S and a molecular weight of 510.55 g/mol. Its IUPAC name is [6-[[4-(3-cyclopentyl-2-methylbenzimidazol-5-yl)-5-fluoropyrimidin-2-yl]amino]-3-pyridinyl]methylsulfonyl formate.
| Compound Name | [6-[[4-(3-cyclopentyl-2-methylbenzimidazol-5-yl)-5-fluoropyrimidin-2-yl]amino]-3-pyridinyl]methylsulfonyl formate |
|---|---|
| PubChem CID | 175078857 |
| Molecular Formula | C24H23FN6O4S |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [6-[[4-(3-cyclopentyl-2-methylbenzimidazol-5-yl)-5-fluoropyrimidin-2-yl]amino]-3-pyridinyl]methylsulfonyl formate |
| SMILES | Cc1nc2ccc(-c3nc(Nc4ccc(CS(=O)(=O)OC=O)cn4)ncc3F)cc2n1C1CCCC1 |
| InChI | InChI=1S/C24H23FN6O4S/c1-15-28-20-8-7-17(10-21(20)31(15)18-4-2-3-5-18)23-19(25)12-27-24(30-23)29-22-9-6-16(11-26-22)13-36(33,34)35-14-32/h6-12,14,18H,2-5,13H2,1H3,(H,26,27,29,30) |
| InChIKey | JXWVRUVHPWWILP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|