C15H19BO4 — CID 175079119
4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoic acid (PubChem CID 175079119) has the molecular formula C15H19BO4 and a molecular weight of 274.13 g/mol. Its IUPAC name is 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 175079119 |
| Molecular Formula | C15H19BO4 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzoic acid |
| SMILES | CC1(C)OB(C=Cc2ccc(C(=O)O)cc2)OC1(C)C |
| InChI | InChI=1S/C15H19BO4/c1-14(2)15(3,4)20-16(19-14)10-9-11-5-7-12(8-6-11)13(17)18/h5-10H,1-4H3,(H,17,18) |
| InChIKey | OXIIKCVKGYFFAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|