C15H9F7 — CID 175079511
1,3,4-trifluoro-5-methyl-2-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene (PubChem CID 175079511) has the molecular formula C15H9F7 and a molecular weight of 322.22 g/mol. Its IUPAC name is 1,3,4-trifluoro-5-methyl-2-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene.
| Compound Name | 1,3,4-trifluoro-5-methyl-2-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 175079511 |
| Molecular Formula | C15H9F7 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1,3,4-trifluoro-5-methyl-2-(1,1,2,2-tetrafluoro-2-phenylethyl)benzene |
| SMILES | Cc1cc(F)c(C(F)(F)C(F)(F)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C15H9F7/c1-8-7-10(16)11(13(18)12(8)17)15(21,22)14(19,20)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | RXUJSOUIDCIEKX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|