About dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene
dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 175079585) has the molecular formula C6H6O3PS+
and a molecular weight of 189.15 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
| PubChem CID | 175079585 |
| Molecular Formula | C6H6O3PS+ |
| Molecular Weight | 189.15 g/mol |
| Exact Mass | 188.98 |
| IUPAC Name | dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | O=[P+](O)O.c1ccc2c(c1)S2 |
| InChI | InChI=1S/C6H4S.HO3P/c1-2-4-6-5(3-1)7-6;1-4(2)3/h1-4H;(H-,1,2,3)/p+1 |
| InChIKey | OQKHLUUCOLDFBR-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene?
The IUPAC name of dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene (CID 175079585) is dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene.
What is the SMILES notation for dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene?
The canonical SMILES for dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene is O=[P+](O)O.c1ccc2c(c1)S2.
What is the InChIKey of dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene?
The InChIKey is OQKHLUUCOLDFBR-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4S.HO3P/c1-2-4-6-5(3-1)7-6;1-4(2)3/h1-4H;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene?
dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene has a molecular weight of 189.15 g/mol, XLogP of 1.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;7-thiabicyclo[4.1.0]hepta-1,3,5-triene is sourced from PubChem (CID 175079585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).