C9H12OS2 — CID 175079897
(1'R,5'R)-spiro[1,3-dithiolane-2,2'-bicyclo[3.1.0]hexane]-3'-carbaldehyde (PubChem CID 175079897) has the molecular formula C9H12OS2 and a molecular weight of 200.33 g/mol. Its IUPAC name is (1'R,5'R)-spiro[1,3-dithiolane-2,2'-bicyclo[3.1.0]hexane]-3'-carbaldehyde.
| Compound Name | (1'R,5'R)-spiro[1,3-dithiolane-2,2'-bicyclo[3.1.0]hexane]-3'-carbaldehyde |
|---|---|
| PubChem CID | 175079897 |
| Molecular Formula | C9H12OS2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (1'R,5'R)-spiro[1,3-dithiolane-2,2'-bicyclo[3.1.0]hexane]-3'-carbaldehyde |
| SMILES | O=CC1C[C@H]2C[C@H]2C12SCCS2 |
| InChI | InChI=1S/C9H12OS2/c10-5-7-3-6-4-8(6)9(7)11-1-2-12-9/h5-8H,1-4H2/t6-,7?,8+/m0/s1 |
| InChIKey | XCSZZNBHQINYHQ-YPVSKDHRSA-N |
| XLogP | 2.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|