C24H34O — CID 175079940
4-[(3,5-ditert-butyl-2,4,6-trimethylphenyl)methyl]phenol (PubChem CID 175079940) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[(3,5-ditert-butyl-2,4,6-trimethylphenyl)methyl]phenol.
| Compound Name | 4-[(3,5-ditert-butyl-2,4,6-trimethylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 175079940 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 4-[(3,5-ditert-butyl-2,4,6-trimethylphenyl)methyl]phenol |
| SMILES | Cc1c(Cc2ccc(O)cc2)c(C)c(C(C)(C)C)c(C)c1C(C)(C)C |
| InChI | InChI=1S/C24H34O/c1-15-20(14-18-10-12-19(25)13-11-18)16(2)22(24(7,8)9)17(3)21(15)23(4,5)6/h10-13,25H,14H2,1-9H3 |
| InChIKey | QBZLHXUAFXIZSZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |