C12H14Br10 — CID 175081059
1,2,3,4,5,6,7,8,9,10-decabromocyclododecane (PubChem CID 175081059) has the molecular formula C12H14Br10 and a molecular weight of 957.28 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10-decabromocyclododecane.
| Compound Name | 1,2,3,4,5,6,7,8,9,10-decabromocyclododecane |
|---|---|
| PubChem CID | 175081059 |
| Molecular Formula | C12H14Br10 |
| Molecular Weight | 957.28 g/mol |
| Exact Mass | 947.29 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10-decabromocyclododecane |
| SMILES | BrC1CCC(Br)C(Br)C(Br)C(Br)C(Br)C(Br)C(Br)C(Br)C1Br |
| InChI | InChI=1S/C12H14Br10/c13-3-1-2-4(14)6(16)8(18)10(20)12(22)11(21)9(19)7(17)5(3)15/h3-12H,1-2H2 |
| InChIKey | BQZJJOVUIFQDDC-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.28 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|