About methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate
methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate (PubChem CID 175081285) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate.
Molecular Properties
| Compound Name | methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate |
| PubChem CID | 175081285 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate |
| SMILES | C=C(C)C1CC(CCC(C)C(=O)OC)C1(C)C |
| InChI | InChI=1S/C15H26O2/c1-10(2)13-9-12(15(13,4)5)8-7-11(3)14(16)17-6/h11-13H,1,7-9H2,2-6H3 |
| InChIKey | RKHFYZTVRUHVBB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate?
The IUPAC name of methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate (CID 175081285) is methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate.
What is the SMILES notation for methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate?
The canonical SMILES for methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate is C=C(C)C1CC(CCC(C)C(=O)OC)C1(C)C.
What is the InChIKey of methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate?
The InChIKey is RKHFYZTVRUHVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-10(2)13-9-12(15(13,4)5)8-7-11(3)14(16)17-6/h11-13H,1,7-9H2,2-6H3.
What are the key properties of methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate?
methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate has a molecular weight of 238.37 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-2-methylbutanoate is sourced from PubChem (CID 175081285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).