C37H42ClNO9 — CID 175081444
(2R,3R,4R,5S)-6-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-[(3-methylphenyl)methoxy]phenyl]methylamino]hexane-1,2,3,4,5-pentol (PubChem CID 175081444) has the molecular formula C37H42ClNO9 and a molecular weight of 680.19 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-[(3-methylphenyl)methoxy]phenyl]methylamino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-[(3-methylphenyl)methoxy]phenyl]methylamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 175081444 |
| Molecular Formula | C37H42ClNO9 |
| Molecular Weight | 680.19 g/mol |
| Exact Mass | 679.25 |
| IUPAC Name | (2R,3R,4R,5S)-6-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-[(3-methylphenyl)methoxy]phenyl]methylamino]hexane-1,2,3,4,5-pentol |
| SMILES | Cc1cccc(COc2cc(OCc3cccc(-c4ccc5c(c4)OCCO5)c3C)c(Cl)cc2CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1 |
| InChI | InChI=1S/C37H42ClNO9/c1-22-5-3-6-24(13-22)20-47-33-16-34(29(38)14-27(33)17-39-18-30(41)36(43)37(44)31(42)19-40)48-21-26-7-4-8-28(23(26)2)25-9-10-32-35(15-25)46-12-11-45-32/h3-10,13-16,30-31,36-37,39-44H,11-12,17-21H2,1-2H3/t30-,31+,36+,37+/m0/s1 |
| InChIKey | DXJBSNMEYOUGCD-LYBFRRHGSA-N |
| XLogP | 4.08 |
| TPSA | 150.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |