C7H11N5O6 — CID 175081587
2-aminoethane-1,1,1-triol;7,9-dihydro-3H-purine-2,6,8-trione (PubChem CID 175081587) has the molecular formula C7H11N5O6 and a molecular weight of 261.19 g/mol. Its IUPAC name is 2-aminoethane-1,1,1-triol;7,9-dihydro-3H-purine-2,6,8-trione.
| Compound Name | 2-aminoethane-1,1,1-triol;7,9-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 175081587 |
| Molecular Formula | C7H11N5O6 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-aminoethane-1,1,1-triol;7,9-dihydro-3H-purine-2,6,8-trione |
| SMILES | NCC(O)(O)O.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C5H4N4O3.C2H7NO3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3;3-1-2(4,5)6/h(H4,6,7,8,9,10,11,12);4-6H,1,3H2 |
| InChIKey | VYPRLAHZXLXTPL-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 201.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|