C23H30O5 — CID 175082046
[(8S,9S,10S,13S,14S,17R)-17-acetyl-6-(hydroxymethyl)-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 175082046) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17R)-17-acetyl-6-(hydroxymethyl)-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,10S,13S,14S,17R)-17-acetyl-6-(hydroxymethyl)-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 175082046 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17R)-17-acetyl-6-(hydroxymethyl)-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3C=C(CO)C4=CC(=O)CC[C@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H30O5/c1-13(25)23(28-14(2)26)9-7-21-20-10-15(12-24)19-11-16(27)4-5-17(19)18(20)6-8-22(21,23)3/h10-11,17-18,20-21,24H,4-9,12H2,1-3H3/t17-,18+,20+,21-,22-,23-/m0/s1 |
| InChIKey | ZYBJYPZVKRMJHY-GXXJFWRLSA-N |
| XLogP | 3.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |