C19H20N4O3 — CID 175082136
(3R,6R)-2,3-diamino-3-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-10-ol (PubChem CID 175082136) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3R,6R)-2,3-diamino-3-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-10-ol.
| Compound Name | (3R,6R)-2,3-diamino-3-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-10-ol |
|---|---|
| PubChem CID | 175082136 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (3R,6R)-2,3-diamino-3-(2-amino-1,3-benzoxazol-5-yl)-6-methyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-10-ol |
| SMILES | C[C@@H]1CC2c3c(cc(O)cc3C(N)[C@]2(N)c2ccc3oc(N)nc3c2)O1 |
| InChI | InChI=1S/C19H20N4O3/c1-8-4-12-16-11(6-10(24)7-15(16)25-8)17(20)19(12,22)9-2-3-14-13(5-9)23-18(21)26-14/h2-3,5-8,12,17,24H,4,20,22H2,1H3,(H2,21,23)/t8-,12?,17?,19+/m1/s1 |
| InChIKey | QOPLUFCVZBLBDG-HVLGRYTGSA-N |
| XLogP | 2.24 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |