C17H19FN2S — CID 175082587
5-[5-(2-fluorophenyl)thiophen-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 175082587) has the molecular formula C17H19FN2S and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-[5-(2-fluorophenyl)thiophen-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[5-(2-fluorophenyl)thiophen-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 175082587 |
| Molecular Formula | C17H19FN2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-[5-(2-fluorophenyl)thiophen-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1CC2CN(c3csc(-c4ccccc4F)c3)CC2C1 |
| InChI | InChI=1S/C17H19FN2S/c1-19-7-12-9-20(10-13(12)8-19)14-6-17(21-11-14)15-4-2-3-5-16(15)18/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | WOUQBQARBQWHIS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |