About [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate
[[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate (PubChem CID 175082755) has the molecular formula C12H13FN2O6
and a molecular weight of 300.24 g/mol. Its IUPAC name is [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate.
Molecular Properties
| Compound Name | [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate |
| PubChem CID | 175082755 |
| Molecular Formula | C12H13FN2O6 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate |
| SMILES | CC(O)CC(=O)ONC(=O)Cc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13FN2O6/c1-7(16)4-12(18)21-14-11(17)6-8-2-3-9(13)10(5-8)15(19)20/h2-3,5,7,16H,4,6H2,1H3,(H,14,17) |
| InChIKey | XOOLYJBQLUOHHO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate?
The IUPAC name of [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate (CID 175082755) is [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate.
What is the SMILES notation for [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate?
The canonical SMILES for [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate is CC(O)CC(=O)ONC(=O)Cc1ccc(F)c([N+](=O)[O-])c1.
What is the InChIKey of [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate?
The InChIKey is XOOLYJBQLUOHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O6/c1-7(16)4-12(18)21-14-11(17)6-8-2-3-9(13)10(5-8)15(19)20/h2-3,5,7,16H,4,6H2,1H3,(H,14,17).
What are the key properties of [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate?
[[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate has a molecular weight of 300.24 g/mol, XLogP of 0.62, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(4-fluoro-3-nitrophenyl)acetyl]amino] 3-hydroxybutanoate is sourced from PubChem (CID 175082755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).