C25H20ClF3N4O4 — CID 175083351
3-[(4S)-10-chloro-1-methyl-6-pyridin-2-yl-9-(trifluoromethyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]propanoyl cyclopropanecarboperoxoate (PubChem CID 175083351) has the molecular formula C25H20ClF3N4O4 and a molecular weight of 532.91 g/mol. Its IUPAC name is 3-[(4S)-10-chloro-1-methyl-6-pyridin-2-yl-9-(trifluoromethyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]propanoyl cyclopropanecarboperoxoate.
| Compound Name | 3-[(4S)-10-chloro-1-methyl-6-pyridin-2-yl-9-(trifluoromethyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]propanoyl cyclopropanecarboperoxoate |
|---|---|
| PubChem CID | 175083351 |
| Molecular Formula | C25H20ClF3N4O4 |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 3-[(4S)-10-chloro-1-methyl-6-pyridin-2-yl-9-(trifluoromethyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]propanoyl cyclopropanecarboperoxoate |
| SMILES | Cc1cnc2n1-c1c(ccc(C(F)(F)F)c1Cl)C(c1ccccn1)=N[C@H]2CCC(=O)OOC(=O)C1CC1 |
| InChI | InChI=1S/C25H20ClF3N4O4/c1-13-12-31-23-18(9-10-19(34)36-37-24(35)14-5-6-14)32-21(17-4-2-3-11-30-17)15-7-8-16(25(27,28)29)20(26)22(15)33(13)23/h2-4,7-8,11-12,14,18H,5-6,9-10H2,1H3/t18-/m0/s1 |
| InChIKey | POOGNZXVPBWODA-SFHVURJKSA-N |
| XLogP | 5.33 |
| TPSA | 95.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|