C23H26ClN3O6 — CID 175083503
diethyl 2-[[5-[(2-chloroacetyl)amino]-6-phenylpyridine-2-carbonyl]amino]pentanedioate (PubChem CID 175083503) has the molecular formula C23H26ClN3O6 and a molecular weight of 475.93 g/mol. Its IUPAC name is diethyl 2-[[5-[(2-chloroacetyl)amino]-6-phenylpyridine-2-carbonyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[5-[(2-chloroacetyl)amino]-6-phenylpyridine-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 175083503 |
| Molecular Formula | C23H26ClN3O6 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | diethyl 2-[[5-[(2-chloroacetyl)amino]-6-phenylpyridine-2-carbonyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(NC(=O)CCl)c(-c2ccccc2)n1)C(=O)OCC |
| InChI | InChI=1S/C23H26ClN3O6/c1-3-32-20(29)13-12-18(23(31)33-4-2)27-22(30)17-11-10-16(25-19(28)14-24)21(26-17)15-8-6-5-7-9-15/h5-11,18H,3-4,12-14H2,1-2H3,(H,25,28)(H,27,30) |
| InChIKey | DHVVSFLURVEDTQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|