C10H7F11 — CID 175083539
1-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene (PubChem CID 175083539) has the molecular formula C10H7F11 and a molecular weight of 336.14 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene.
| Compound Name | 1-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene |
|---|---|
| PubChem CID | 175083539 |
| Molecular Formula | C10H7F11 |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclopentene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(C1=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H7F11/c11-6(9(16,17)18,5-3-1-2-4-5)7(12,13)8(14,15)10(19,20)21/h3H,1-2,4H2 |
| InChIKey | DAMRCTBCTASOCD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|