C12H13N3O3S — CID 175083546
3-(2-methoxyphenyl)sulfonylpyridine-2,6-diamine (PubChem CID 175083546) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)sulfonylpyridine-2,6-diamine.
| Compound Name | 3-(2-methoxyphenyl)sulfonylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 175083546 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(2-methoxyphenyl)sulfonylpyridine-2,6-diamine |
| SMILES | COc1ccccc1S(=O)(=O)c1ccc(N)nc1N |
| InChI | InChI=1S/C12H13N3O3S/c1-18-8-4-2-3-5-9(8)19(16,17)10-6-7-11(13)15-12(10)14/h2-7H,1H3,(H4,13,14,15) |
| InChIKey | DFDRKKPGYVXRSE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |