C22H25FN4O6S — CID 175083925
4-(dioxan-4-ylmethoxy)-1-(4-fluorophenyl)-N-methylsulfonyl-3-propan-2-ylpyrazolo[5,4-b]pyridine-6-carboxamide (PubChem CID 175083925) has the molecular formula C22H25FN4O6S and a molecular weight of 492.53 g/mol. Its IUPAC name is 4-(dioxan-4-ylmethoxy)-1-(4-fluorophenyl)-N-methylsulfonyl-3-propan-2-ylpyrazolo[5,4-b]pyridine-6-carboxamide.
| Compound Name | 4-(dioxan-4-ylmethoxy)-1-(4-fluorophenyl)-N-methylsulfonyl-3-propan-2-ylpyrazolo[5,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 175083925 |
| Molecular Formula | C22H25FN4O6S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 4-(dioxan-4-ylmethoxy)-1-(4-fluorophenyl)-N-methylsulfonyl-3-propan-2-ylpyrazolo[5,4-b]pyridine-6-carboxamide |
| SMILES | CC(C)c1nn(-c2ccc(F)cc2)c2nc(C(=O)NS(C)(=O)=O)cc(OCC3CCOOC3)c12 |
| InChI | InChI=1S/C22H25FN4O6S/c1-13(2)20-19-18(31-11-14-8-9-32-33-12-14)10-17(22(28)26-34(3,29)30)24-21(19)27(25-20)16-6-4-15(23)5-7-16/h4-7,10,13-14H,8-9,11-12H2,1-3H3,(H,26,28) |
| InChIKey | JYANYQJWZMSVOX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|