C8H5F9 — CID 175084075
1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclobutene (PubChem CID 175084075) has the molecular formula C8H5F9 and a molecular weight of 272.11 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclobutene.
| Compound Name | 1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclobutene |
|---|---|
| PubChem CID | 175084075 |
| Molecular Formula | C8H5F9 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 1-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)cyclobutene |
| SMILES | FC(F)(F)C(F)(F)C(F)(C1=CCC1)C(F)(F)F |
| InChI | InChI=1S/C8H5F9/c9-5(7(12,13)14,4-2-1-3-4)6(10,11)8(15,16)17/h2H,1,3H2 |
| InChIKey | GMJPIGZBQOIGOC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|